For research use only. Not for therapeutic Use.
Taurultam (Cat.No:R060219) is a β-lactam compound with a unique structure that lacks the conventional β-lactam ring. Originally developed as an antibacterial agent, taurultam’s distinct mechanism of action involves inhibition of bacterial penicillin-binding proteins. Its potential applications have expanded to include research in antimicrobial resistance and other medical fields.
Catalog Number | R060219 |
CAS Number | 38668-01-8 |
Synonyms | Tetrahydro-2H-1,2,4-thiadiazine 1,1-Dioxide; ?1,1-Dioxoperhydro-1,2,4-thiadiazine; Perhydro-1,2,4-thiadiazine 1,1-Dioxide; Tetrahydro-2H-1,2,4-thiadiazine 1,1-Dioxide |
Molecular Formula | C3H8N2O2S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,2,4-thiadiazinane 1,1-dioxide |
InChI | InChI=1S/C3H8N2O2S/c6-8(7)2-1-4-3-5-8/h4-5H,1-3H2 |
InChIKey | RJGYJMFQWGPBGM-UHFFFAOYSA-N |
SMILES | C1CS(=O)(=O)NCN1 |