For research use only. Not for therapeutic Use.
Tazemetostat de(methyl morpholine)-COOH(Cat No.:I042651)is a derivative of tazemetostat, an epigenetic inhibitor that targets the EZH2 enzyme, which is involved in the methylation of histones and the regulation of gene expression. By inhibiting EZH2, tazemetostat disrupts abnormal gene silencing associated with various cancers, particularly those with EZH2 mutations. The addition of a de(methyl morpholine)-COOH group enhances its stability and solubility. This compound is primarily studied for its potential therapeutic applications in the treatment of lymphoma and other cancers, with an emphasis on restoring normal gene expression and inhibiting tumor progression.
CAS Number | 2685873-44-1 |
Synonyms | 4-[3-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methylcarbamoyl]-5-[ethyl(oxan-4-yl)amino]-4-methylphenyl]benzoic acid |
Molecular Formula | C30H35N3O5 |
Purity | ≥95% |
IUPAC Name | 4-[3-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methylcarbamoyl]-5-[ethyl(oxan-4-yl)amino]-4-methylphenyl]benzoic acid |
InChI | InChI=1S/C30H35N3O5/c1-5-33(24-10-12-38-13-11-24)27-16-23(21-6-8-22(9-7-21)30(36)37)15-25(20(27)4)28(34)31-17-26-18(2)14-19(3)32-29(26)35/h6-9,14-16,24H,5,10-13,17H2,1-4H3,(H,31,34)(H,32,35)(H,36,37) |
InChIKey | MIEXIPQREXYLRA-UHFFFAOYSA-N |
SMILES | CCN(C1CCOCC1)C2=CC(=CC(=C2C)C(=O)NCC3=C(C=C(NC3=O)C)C)C4=CC=C(C=C4)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |