For research use only. Not for therapeutic Use.
TBDPS-CHC is a novel potent MCT1 inhibitor, exhibiting good single agent anticancer efficacy properties.
| Catalog Number | I037026 |
| Synonyms | TBDPS-CHC |
| Molecular Formula | C26H25NO3Si |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (E)-3-(4-((tert-butyldiphenylsilyl)oxy)phenyl)-2-cyanoacrylic acid |
| InChI | InChI=1S/C26H25NO3Si/c1-26(2,3)31(23-10-6-4-7-11-23,24-12-8-5-9-13-24)30-22-16-14-20(15-17-22)18-21(19-27)25(28)29/h4-18H,1-3H3,(H,28,29)/b21-18+ |
| InChIKey | ISJVSHIKNUAOEB-DYTRJAOYSA-N |
| SMILES | O=C(O)/C(C#N)=C/C1=CC=C(O[Si](C2=CC=CC=C2)(C(C)(C)C)C3=CC=CC=C3)C=C1 |
