For research use only. Not for therapeutic Use.
TBK1/IKKε-IN-5(Cat No.:I018956)is a selective inhibitor targeting TANK-binding kinase 1 (TBK1) and IκB kinase epsilon (IKKε), two critical enzymes involved in the regulation of immune response and inflammation. Both kinases play a key role in activating the NF-κB and interferon signaling pathways, which are implicated in various inflammatory diseases, cancer, and autoimmune disorders. By inhibiting TBK1 and IKKε, TBK1/IKKε-IN-5 has shown potential as a therapeutic agent in conditions like viral infections, autoimmune diseases, and cancer, with ongoing research exploring its efficacy, safety, and clinical applications.
CAS Number | 1893397-65-3 |
Molecular Formula | C₂₈H₃₁N₇O₃ |
Purity | ≥95% |
Target | IKK |
IUPAC Name | 2-(oxan-4-yloxy)-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
InChI | InChI=1S/C28H31N7O3/c29-16-21-15-20(1-6-26(21)38-25-7-13-36-14-8-25)27-30-19-31-28(33-27)32-22-2-4-23(5-3-22)34-9-11-35(12-10-34)24-17-37-18-24/h1-6,15,19,24-25H,7-14,17-18H2,(H,30,31,32,33) |
InChIKey | QYQFLAQHGHBIFA-UHFFFAOYSA-N |
SMILES | C1COCCC1OC2=C(C=C(C=C2)C3=NC(=NC=N3)NC4=CC=C(C=C4)N5CCN(CC5)C6COC6)C#N |