For research use only. Not for therapeutic Use.
TBS-<wbr></wbr>Corey lactone aldehyde is a versatile, hydroxyl-<wbr></wbr>protected intermediate for the synthesis of prostaglandins and prostaglandin analogs. Prostaglandin derivatives with modifications in the alpha chain, the omega chain, or both, are readily accessible from TBS-<wbr></wbr>Corey aldehyde.
| Catalog Number | R067338 |
| CAS Number | 64091-14-1 |
| Synonyms | [3aR-(3aa,4a,5b,6aa)]-5-(tert-butyl-dimethylsilyl)hexahydro-2-oxo-2H-cyclopenta[b]furan-4-carboxaldehyde |
| Molecular Formula | C14H21O4Si |
| Purity | ≥95% |
| Storage | -20°C |
| InChI | InChI=1S/C14H24O4Si/c1-14(2,3)19(4,5)18-12-7-11-9(10(12)8-15)6-13(16)17-11/h8-12H,6-7H2,1-5H3/t9-,10?,11+,12-/m1/s1 |
| InChIKey | CLCQNBJFWQERSS-SGUBAKSOSA-N |
| SMILES | O=C1C[C@@H]2[C@@H](C=O)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]2O1 |
| Reference | 1.Bindra, J.S., and Bindra, R. Prostaglandin Synthesis. (1977). |
