For research use only. Not for therapeutic Use.
TCL053（Cat No.:I043377）is a small-molecule inhibitor targeting specific proteins involved in the regulation of immune cell activation and signaling. By modulating these pathways, TCL053 shows potential in treating autoimmune diseases and certain types of cancer. It works by selectively inhibiting key enzymes or receptors that drive inflammation and tumor progression, thus reducing immune cell dysfunction or abnormal growth. Preclinical studies have demonstrated its ability to suppress autoimmune responses and inhibit tumor cell proliferation. Ongoing research focuses on evaluating its safety, efficacy, and potential clinical applications, especially in combination therapies for immune-related conditions and cancer.
| CAS Number | 2361162-70-9 |
| Synonyms | [2-[4-(dimethylamino)butanoyloxymethyl]-3-[(Z)-tetradec-9-enoyl]oxy-2-[[(Z)-tetradec-9-enoyl]oxymethyl]propyl] (Z)-tetradec-9-enoate |
| Molecular Formula | C53H95NO8 |
| Purity | ≥95% |
| IUPAC Name | [2-[4-(dimethylamino)butanoyloxymethyl]-3-[(Z)-tetradec-9-enoyl]oxy-2-[[(Z)-tetradec-9-enoyl]oxymethyl]propyl] (Z)-tetradec-9-enoate |
| InChI | InChI=1S/C53H95NO8/c1-6-9-12-15-18-21-24-27-30-33-36-40-49(55)59-45-53(48-62-52(58)43-39-44-54(4)5,46-60-50(56)41-37-34-31-28-25-22-19-16-13-10-7-2)47-61-51(57)42-38-35-32-29-26-23-20-17-14-11-8-3/h15-20H,6-14,21-48H2,1-5H3/b18-15-,19-16-,20-17- |
| InChIKey | MJPUTLHISFHJJZ-QMJZYSMNSA-N |
| SMILES | CCCC/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCN(C)C)(COC(=O)CCCCCCC/C=C\CCCC)COC(=O)CCCCCCC/C=C\CCCC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
