For research use only. Not for therapeutic Use.
TCMTB (2-(Thiocyanomethylthio)benzothiazole) is an organosulfur compound widely used as a biocide in industrial applications. It is particularly effective as a fungicide and bactericide, primarily in leather processing, water treatment systems, and the paper industry, where it helps control microbial growth and prevent material degradation. TCMTB functions by disrupting microbial cell function, making it highly effective against a broad spectrum of fungi and bacteria. However, due to its toxicity, its use is carefully regulated to minimize environmental impact and ensure safe handling. Its versatility and efficiency make TCMTB a valuable agent in industrial microbiological control.
| Catalog Number | R049967 |
| CAS Number | 21564-17-0 |
| Synonyms | 2-(Thiocyanomethylthio)benzothiazole; 2-(Thiocyanomethylthio)benzothiazole; Superdavloxan. |
| Molecular Formula | C9H6N2S3 |
| Purity | ≥95% |
| Solubility | Very slightly soluble (0.125 g/L at 24 ° C) |
| Appearance | Red to brown liquid with pungent odor |
| Storage | -20°C |
| IUPAC Name | 1,3-benzothiazol-2-ylsulfanylmethyl thiocyanate |
| InChI | InChI=1S/C9H6N2S3/c10-5-12-6-13-9-11-7-3-1-2-4-8(7)14-9/h1-4H,6H2 |
| InChIKey | TUBQDCKAWGHZPF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)SCSC#N |
