For research use only. Not for therapeutic Use.
JNK inhibitor IX(Cat No.:I003105), also known as TCS JNK 5a, is a potent and highly selective inhibitor of c-Jun N-terminal kinases (JNKs). It exhibits high affinity for JNK2 and JNK3 isoforms with pIC50 values of 6.5 and 6.7, respectively. By inhibiting JNK activity, JNK inhibitor IX disrupts the JNK signaling pathway, which is involved in various cellular processes such as inflammation, apoptosis, and stress response. Its selectivity towards JNK isoforms makes it a valuable tool for studying the specific roles of JNK2 and JNK3 in cellular functions and disease pathways.
Catalog Number | I003105 |
CAS Number | 312917-14-9 |
Synonyms | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)naphthalene-1-carboxamide |
Molecular Formula | C₂₀H₁₆N₂OS |
Purity | ≥95% |
Target | Apoptosis |
Solubility | DMSO: ≥ 51 mg/mL |
Storage | Room Temperature |
IC50 | 6.7/6.5(pIC50, JNK3/JNK2) |
IUPAC Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)naphthalene-1-carboxamide |
InChI | InChI=1S/C20H16N2OS/c21-12-17-15-9-3-4-11-18(15)24-20(17)22-19(23)16-10-5-7-13-6-1-2-8-14(13)16/h1-2,5-8,10H,3-4,9,11H2,(H,22,23) |
InChIKey | WQGDQGAFSDMBLA-UHFFFAOYSA-N |
SMILES | C1CCC2=C(C1)C(=C(S2)NC(=O)C3=CC=CC4=CC=CC=C43)C#N |
Reference | <p style=/line-height:25px/> |