For research use only. Not for therapeutic Use.
Antiprion agent. Potently inhibits protease-resistant prion protein (PrP-res) accumulation in two types of prion-infected mouse neuroblastoma (N2a) cell lines (IC<sub>50</sub> = 3 nM).
| Catalog Number | I010726 |
| CAS Number | 34320-83-7 |
| Synonyms | 2,4-Dihydro-5-(4-nitrophenyl)-2-phenyl-3H-pyrazol-3-one |
| Molecular Formula | C15H11N3O3 |
| Purity | ≥95% |
| Target | Neuronal Metabolism |
| Solubility | Soluble to 100 mM in DMSO and to 25 mM in ethanol |
| Storage | Store at +4C |
| IUPAC Name | 5-(4-nitrophenyl)-2-phenyl-4H-pyrazol-3-one |
| InChI | InChI=1S/C15H11N3O3/c19-15-10-14(11-6-8-13(9-7-11)18(20)21)16-17(15)12-4-2-1-3-5-12/h1-9H,10H2 |
| InChIKey | FDAVFKZPGQEGDX-UHFFFAOYSA-N |
| SMILES | C1C(=NN(C1=O)C2=CC=CC=C2)C3=CC=C(C=C3)[N+](=O)[O-] |
