For research use only. Not for therapeutic Use.
TDZD-8（Cat No.:I003158）is a small molecule compound that acts as a selective inhibitor of glycogen synthase kinase-3 (GSK-3). GSK-3 is involved in various cellular processes, including cell division, differentiation, and apoptosis, as well as the regulation of metabolic and neurodegenerative pathways. TDZD-8 is primarily studied for its potential in treating neurodegenerative diseases like Alzheimer’s and Parkinson’s, as inhibiting GSK-3 can help reduce tau phosphorylation and amyloid accumulation, key features of these diseases. It is also being investigated for its role in promoting neuroprotection and improving cognitive function in certain neurological disorders.
| Catalog Number | I003158 |
| CAS Number | 327036-89-5 |
| Synonyms | 4-benzyl-2-methyl-1,2,4-thiadiazolidine-3,5-dione |
| Molecular Formula | C₁₀H₁₀N₂O₂S |
| Purity | ≥95% |
| Target | Stem Cell/Wnt |
| Solubility | 10 mM in DMSO |
| Storage | 3 years -20C powder |
| IC50 | 2 uM (GSK3β) |
| IUPAC Name | 4-benzyl-2-methyl-1,2,4-thiadiazolidine-3,5-dione |
| InChI | InChI=1S/C10H10N2O2S/c1-11-9(13)12(10(14)15-11)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| InChIKey | JDSJDASOXWCHPN-UHFFFAOYSA-N |
| SMILES | CN1C(=O)N(C(=O)S1)CC2=CC=CC=C2 |
