For research use only. Not for therapeutic Use.
TEAD-IN-2（Cat No.:I043436）is a small-molecule inhibitor targeting the TEAD (TEA domain) transcription factors, which play a crucial role in regulating cell proliferation, survival, and development, particularly in the Hippo signaling pathway. By inhibiting TEAD activity, TEAD-IN-2 disrupts downstream transcriptional processes involved in tumor growth, metastasis, and organ size regulation. This makes TEAD-IN-2 a promising candidate for cancer therapies, particularly in tumors where the Hippo pathway is dysregulated. Preclinical studies have shown potential in reducing tumor growth, and ongoing research aims to explore its safety, efficacy, and clinical applications.
| CAS Number | 2563849-97-6 |
| Synonyms | 3-bromo-5-[1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]-4,5-dihydro-1,2-oxazole |
| Molecular Formula | C16H18BrF3N2O |
| Purity | ≥95% |
| IUPAC Name | 3-bromo-5-[1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]-4,5-dihydro-1,2-oxazole |
| InChI | InChI=1S/C16H18BrF3N2O/c17-15-9-14(23-21-15)12-5-7-22(8-6-12)10-11-1-3-13(4-2-11)16(18,19)20/h1-4,12,14H,5-10H2 |
| InChIKey | PGYSFRYXGVNVIO-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C2CC(=NO2)Br)CC3=CC=C(C=C3)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
