For research use only. Not for therapeutic Use.
Teclozan（Cat No.:I037078）is an antiprotozoal medication primarily used for treating infections caused by Entamoeba histolytica, the parasite responsible for amoebiasis. It works by targeting the metabolic processes of the parasite, effectively halting its growth and clearing the infection from the gastrointestinal tract. Known for its high efficacy and tolerability, Teclozan is often prescribed in cases of intestinal amoebiasis, providing a reliable treatment option for both acute and chronic infections. Its minimal side effects make it suitable for prolonged use, contributing to its value in managing amoebic infections in endemic areas.
| Catalog Number | I037078 |
| CAS Number | 5560-78-1 |
| Synonyms | Teclozan; Falmonox; Teclosine; Teclozine; NSC 107433; Teclosan; Teclosine; Win 13146; Win-13146; Win13146; Win-AM 13146; |
| Molecular Formula | C20H28Cl4N2O4 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | 4°C, protect from light |
| IUPAC Name | 2,2-dichloro-N-[[4-[[(2,2-dichloroacetyl)-(2-ethoxyethyl)amino]methyl]phenyl]methyl]-N-(2-ethoxyethyl)acetamide |
| InChI | InChI=1S/C20H28Cl4N2O4/c1-3-29-11-9-25(19(27)17(21)22)13-15-5-7-16(8-6-15)14-26(10-12-30-4-2)20(28)18(23)24/h5-8,17-18H,3-4,9-14H2,1-2H3 |
| InChIKey | MSJLJWCAEPENBL-UHFFFAOYSA-N |
| SMILES | CCOCCN(CC1=CC=C(C=C1)CN(CCOCC)C(=O)C(Cl)Cl)C(=O)C(Cl)Cl |
| Reference | 1: Antiamoebic drugs for treating amoebic colitis Maria Liza M Gonzales, Leonila F Dans, Juliet Sio‐Aguilar |
