For research use only. Not for therapeutic Use.
Tecnazene（Cat No.:R020202）is an antifungal agent primarily used in the treatment of dermatophyte infections such as athlete’s foot, ringworm, and other skin fungal conditions. It works by inhibiting the growth of fungal cells, effectively preventing the spread of the infection. Tecnazene is often found in topical creams, powders, and ointments. Its broad-spectrum activity against various fungi makes it a valuable treatment option for skin infections caused by dermatophytes. Research on its efficacy, safety profile, and potential applications in other fungal diseases continues to support its use in dermatological care.
| CAS Number | 117-18-0 |
| Synonyms | 1,2,4,5-tetrachloro-3-nitrobenzene |
| Molecular Formula | C6HCl4NO2 |
| Purity | ≥95% |
| IUPAC Name | 1,2,4,5-tetrachloro-3-nitrobenzene |
| InChI | InChI=1S/C6HCl4NO2/c7-2-1-3(8)5(10)6(4(2)9)11(12)13/h1H |
| InChIKey | XQTLDIFVVHJORV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)[N+](=O)[O-])Cl)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
