For research use only. Not for therapeutic Use.
Tegeprotafib（Cat No.:I041155）is an experimental small molecule drug that targets and inhibits the enzyme autotaxin, which is responsible for the production of lysophosphatidic acid (LPA). LPA is a bioactive lipid involved in various cellular processes, including inflammation, cell proliferation, and fibrosis. By inhibiting autotaxin, Tegeprotafib reduces LPA levels, potentially offering therapeutic benefits in diseases where LPA plays a key role, such as cancer, fibrotic disorders, and autoimmune diseases. The compound is being investigated for its potential to treat conditions characterized by excessive tissue fibrosis and abnormal cellular signaling.
| CAS Number | 2407610-46-0 |
| Synonyms | 5-(1-fluoro-3-hydroxy-7-methoxynaphthalen-2-yl)-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| Molecular Formula | C13H11FN2O5S |
| Purity | ≥95% |
| IUPAC Name | 5-(1-fluoro-3-hydroxy-7-methoxynaphthalen-2-yl)-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| InChI | InChI=1S/C13H11FN2O5S/c1-21-8-3-2-7-4-10(17)13(12(14)9(7)5-8)16-6-11(18)15-22(16,19)20/h2-5,17H,6H2,1H3,(H,15,18) |
| InChIKey | CPLSFGHDGOFDRP-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C(C=C2C=C1)O)N3CC(=O)NS3(=O)=O)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
