For research use only. Not for therapeutic Use.
Telmisartan-d3 (CAS 1189889-44-8) is a high-purity deuterated compound used in advanced pharmaceutical research. This isotopically labeled version of Telmisartan is crucial for studies involving antihypertensive drugs, pharmacokinetics, and metabolic pathways. Featuring three deuterium atoms, it ensures precise and reliable analytical results. Its advanced formulation provides enhanced stability and consistency, making it suitable for various experimental setups. Ideal for cardiovascular research and drug development, Telmisartan-d3 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| CAS Number | 1189889-44-8 |
| Molecular Formula | C33H27D3N4O2 |
| Purity | ≥95% |
| Target | Autophagy |
| IUPAC Name | 2-[4-[[4-methyl-2-propyl-6-[1-(trideuteriomethyl)benzimidazol-2-yl]benzimidazol-1-yl]methyl]phenyl]benzoic acid |
| InChI | InChI=1S/C33H30N4O2/c1-4-9-30-35-31-21(2)18-24(32-34-27-12-7-8-13-28(27)36(32)3)19-29(31)37(30)20-22-14-16-23(17-15-22)25-10-5-6-11-26(25)33(38)39/h5-8,10-19H,4,9,20H2,1-3H3,(H,38,39)/i3D3 |
| InChIKey | RMMXLENWKUUMAY-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])N1C2=CC=CC=C2N=C1C3=CC4=C(C(=C3)C)N=C(N4CC5=CC=C(C=C5)C6=CC=CC=C6C(=O)O)CCC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
