For research use only. Not for therapeutic Use.
Telocinobufagin(Cat No.:I000011)is a naturally occurring bufadienolide with potent cardiotonic and anticancer properties. It is derived from toad venom and exhibits strong inhibitory effects on Na+/K+-ATPase, leading to increased intracellular calcium levels and enhanced cardiac contractility. In cancer research, telocinobufagin induces apoptosis and inhibits tumor cell proliferation by disrupting various cellular pathways. Its unique mechanism of action makes it a valuable compound for exploring new therapeutic avenues in both cardiovascular and oncology fields. Telocinobufagin’s dual functionality highlights its potential in advanced pharmaceutical research.
Catalog Number | I000011 |
CAS Number | 472-26-4 |
Molecular Formula | C24H34O5 |
Purity | ≥95% |
Target | Disease Research Fields |
Solubility | 10 mM in DMSO, Chloroform (Sparingly), Methanol (Sparingly) |
Storage | 3 years -20C powder |
IUPAC Name | 5-[(3S,5S,8R,9S,10R,13R,14S,17R)-3,5,14-trihydroxy-10,13-dimethyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one |
InChI | InChI=1S/C24H34O5/c1-21-9-5-16(25)13-23(21,27)11-7-19-18(21)6-10-22(2)17(8-12-24(19,22)28)15-3-4-20(26)29-14-15/h3-4,14,16-19,25,27-28H,5-13H2,1-2H3/t16-,17+,18-,19+,21+,22+,23-,24-/m0/s1 |
InChIKey | PBSOJKPTQWWJJD-ZBDZJSKLSA-N |
SMILES | CC12CCC(CC1(CCC3C2CCC4(C3(CCC4C5=COC(=O)C=C5)O)C)O)O |