For research use only. Not for therapeutic Use.
Telomerase-IN-3 is a telomerase inhibitor, which directly targets hTERT promoter activity. hTERT is the key component for maintenance of telomerase activity[1].
| Catalog Number | I017866 |
| CAS Number | 150096-77-8 |
| Synonyms | 2-amino-N-[[4-(5-chloropyrimidin-2-yl)oxy-3-methylphenyl]carbamoyl]benzamide |
| Molecular Formula | C19H16ClN5O3 |
| Purity | ≥95% |
| InChI | InChI=1S/C19H16ClN5O3/c1-11-8-13(6-7-16(11)28-19-22-9-12(20)10-23-19)24-18(27)25-17(26)14-4-2-3-5-15(14)21/h2-10H,21H2,1H3,(H2,24,25,26,27) |
| InChIKey | NLVSCQFSPVSAOF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)NC(=O)NC(=O)C2=CC=CC=C2N)OC3=NC=C(C=N3)Cl |
| Reference | [1]. Laurence Hurley, et al. hTERT MODULATORS AND METHODS OF USE. WO2017095969A1. |
