For research use only. Not for therapeutic Use.
Teloxantrone（Cat No.:I009744）is an experimental anticancer drug that belongs to the class of anthraquinone derivatives. It works by intercalating into DNA and inhibiting topoisomerase II, an enzyme essential for DNA replication and repair. This leads to DNA damage and ultimately induces cell death, particularly in rapidly dividing cancer cells. Teloxantrone has shown potential activity against various types of cancers, including breast cancer, leukemia, and lymphoma. Currently undergoing clinical trials, its safety, efficacy, and long-term effects are still under investigation. Researchers are exploring its potential as part of combination chemotherapy regimens.
| Catalog Number | I009744 |
| CAS Number | 91441-48-4 |
| Synonyms | Teloxantrone; CI937; DUP937.;7,10-dihydroxy-2-(2-((2-hydroxyethyl)amino)ethyl)-5-((2-(methylamino)ethyl)amino)dibenzo[cd,g]indazol-6(2H)-one |
| Molecular Formula | C21H25N5O4 |
| Purity | ≥95% |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| IUPAC Name | 6,8-dihydroxy-14-[2-(2-hydroxyethylamino)ethyl]-10-[2-(methylamino)ethylimino]-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1,4,6,8,11,13(16)-hexaen-3-one |
| InChI | InChI=1S/C21H25N5O4/c1-22-6-7-24-12-2-3-13-17-16(12)21(30)19-15(29)5-4-14(28)18(19)20(17)25-26(13)10-8-23-9-11-27/h2-5,22-23,25,27,29-30H,6-11H2,1H3 |
| InChIKey | WOPAVGQTOMNFGS-UHFFFAOYSA-N |
| SMILES | CNCCN=C1C=CC2=C3C1=C(C4=C(C=CC(=O)C4=C3NN2CCNCCO)O)O |
