For research use only. Not for therapeutic Use.
Temephos(Cat No.:I003225)is an organophosphate insecticide widely used to control mosquito larvae in public health programs, particularly for managing vector-borne diseases such as malaria and dengue. It acts by inhibiting acetylcholinesterase, disrupting nerve impulses in insect larvae and leading to their death. Temephos is applied to standing water sources where mosquitoes breed, providing targeted larvicidal action while minimizing impact on non-target species. Known for its effectiveness and environmental safety when used as directed, temephos plays a crucial role in integrated pest management strategies to reduce disease transmission.
CAS Number | 3383-96-8 |
Molecular Formula | C16H20O6P2S3 |
Purity | ≥95% |
Target | Parasite |
Solubility | 10 mM in DMSO |
Storage | 3 years -20C powder |
IUPAC Name | [4-(4-dimethoxyphosphinothioyloxyphenyl)sulfanylphenoxy]-dimethoxy-sulfanylidene-lambda5-phosphane |
InChI | InChI=1S/C16H20O6P2S3/c1-17-23(25,18-2)21-13-5-9-15(10-6-13)27-16-11-7-14(8-12-16)22-24(26,19-3)20-4/h5-12H,1-4H3 |
InChIKey | WWJZWCUNLNYYAU-UHFFFAOYSA-N |
SMILES | COP(=S)(OC)OC1=CC=C(C=C1)SC2=CC=C(C=C2)OP(=S)(OC)OC |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |