For research use only. Not for therapeutic Use.
Temocapril（Cat No.:I009749）is an angiotensin-converting enzyme (ACE) inhibitor used primarily in the treatment of hypertension and heart failure. It works by blocking the conversion of angiotensin I to angiotensin II, a potent vasoconstrictor, leading to vasodilation and reduced blood pressure. By lowering blood pressure and decreasing the workload on the heart, Temocapril helps improve cardiovascular function and prevent complications related to high blood pressure. It is often prescribed to reduce the risk of stroke, heart attack, and kidney problems, particularly in patients with cardiovascular diseases or diabetes.
| CAS Number | 111902-57-9 |
| Synonyms | 2-[(2S,6R)-6-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]-5-oxo-2-thiophen-2-yl-1,4-thiazepan-4-yl]acetic acid |
| Molecular Formula | C23H28N2O5S2 |
| Purity | ≥95% |
| IUPAC Name | 2-[(2S,6R)-6-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]-5-oxo-2-thiophen-2-yl-1,4-thiazepan-4-yl]acetic acid |
| InChI | InChI=1S/C23H28N2O5S2/c1-2-30-23(29)17(11-10-16-7-4-3-5-8-16)24-18-15-32-20(19-9-6-12-31-19)13-25(22(18)28)14-21(26)27/h3-9,12,17-18,20,24H,2,10-11,13-15H2,1H3,(H,26,27)/t17-,18-,20-/m0/s1 |
| InChIKey | FIQOFIRCTOWDOW-BJLQDIEVSA-N |
| SMILES | CCOC(=O)[C@H](CCC1=CC=CC=C1)N[C@H]2CS[C@@H](CN(C2=O)CC(=O)O)C3=CC=CS3 |
