For research use only. Not for therapeutic Use.
Temozolomide（Cat No.:A001097）is an oral alkylating agent used primarily in the treatment of glioblastoma multiforme and refractory anaplastic astrocytoma. This chemotherapeutic drug functions by methylating DNA, thereby hindering cancer cell replication. Known for its ability to cross the blood-brain barrier, temozolomide is pivotal in treating brain tumors. Its efficacy is often enhanced when used alongside radiotherapy. As a key player in oncology, temozolomide’s role in cancer treatment extends to ongoing research exploring its potential in other malignancies. High purity temozolomide ensures reliable and effective therapeutic outcomes.
| Catalog Number | A001097 |
| CAS Number | 85622-93-1 |
| Synonyms | CCRG81045, NSC 362856 |
| Molecular Formula | C6H6N6O2 |
| Purity | ≥95% |
| Target | Autophagy |
| Solubility | >6.6mg/mL in DMSO |
| Storage | 3 years -20C powder |
| IUPAC Name | 3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
| InChI | InChI=1S/C6H6N6O2/c1-11-6(14)12-2-8-3(4(7)13)5(12)9-10-11/h2H,1H3,(H2,7,13) |
| InChIKey | BPEGJWRSRHCHSN-UHFFFAOYSA-N |
| SMILES | CN1C(=O)N2C=NC(=C2N=N1)C(=O)N |
