For research use only. Not for therapeutic Use.
Temozolomide-d3（Cat No.:S000308） is a deuterated variant of temozolomide, where three hydrogen atoms are replaced with deuterium. This alteration enhances the molecule’s stability and is useful as an internal standard in analytical applications, including mass spectrometry and NMR spectroscopy. Temozolomide itself is an oral chemotherapy drug widely used to treat certain types of brain tumors, such as glioblastoma multiforme. By incorporating deuterium, temozolomide-d3 allows for more accurate tracking and analysis of the drug’s metabolic pathways, degradation, and mechanism of action within biological systems, aiding in pharmacokinetic and pharmacodynamic studies.
| Catalog Number | S000308 |
| CAS Number | 208107-14-6 |
| Molecular Formula | C6H3D3N6O2 |
| Purity | ≥95% |
| IUPAC Name | 4-oxo-3-(trideuteriomethyl)imidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
| InChI | InChI=1S/C6H6N6O2/c1-11-6(14)12-2-8-3(4(7)13)5(12)9-10-11/h2H,1H3,(H2,7,13)/i1D3 |
| InChIKey | BPEGJWRSRHCHSN-FIBGUPNXSA-N |
| SMILES | CN1C(=O)N2C=NC(=C2N=N1)C(=O)N |
