For research use only. Not for therapeutic Use.
Tenofovir amibufenamide is an antiviral compound.
| Catalog Number | I037119 |
| CAS Number | 1571076-26-0 |
| Synonyms | Tenofovir amibufenamide |
| Molecular Formula | C22H31N6O5P |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | propan-2-yl 2-{[(S)-({[(2R)-1-(6-amino-9H-purin-9-yl)propan-2-yl]oxy}methyl)(phenoxy)phosphinoyl]amino}-2-methylpropanoate |
| InChI | InChI=1S/C22H31N6O5P/c1-15(2)32-21(29)22(4,5)27-34(30,33-17-9-7-6-8-10-17)14-31-16(3)11-28-13-26-18-19(23)24-12-25-20(18)28/h6-10,12-13,15-16H,11,14H2,1-5H3,(H,27,30)(H2,23,24,25)/t16-,34+/m1/s1 |
| InChIKey | ORHSFGJQGPUCRR-RZCFMFBHSA-N |
| SMILES | CC(C)(N[P@@](OC1=CC=CC=C1)(CO[C@H](C)CN2C=NC3=C(N)N=CN=C23)=O)C(OC(C)C)=O |
