Tenofovir diphosphate(CAT: M133400) is the active intracellular form of the antiretroviral drug tenofovir, which is used in the treatment of HIV and hepatitis B infections. After tenofovir is administered, it undergoes phosphorylation within the cells to form tenofovir diphosphate. This active metabolite inhibits the viral enzyme reverse transcriptase by incorporating itself into the viral DNA, leading to chain termination and preventing viral replication. Tenofovir diphosphate is critical in controlling viral load and is a key component of many combination therapies used in the management of HIV/AIDS and chronic hepatitis B. Its efficacy and long intracellular half-life make it a cornerstone in antiviral treatments.
| Catalog Number | M133400 |
| CAS Number | 166403-66-3 |
| Molecular Formula | C9H16N5O10P3 |
| Purity | ≥95% |
| Storage | Desiccate at RT |
| IUPAC Name | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid |
| InChI | InChI=1S/C9H16N5O10P3/c1-6(2-14-4-13-7-8(10)11-3-12-9(7)14)22-5-25(15,16)23-27(20,21)24-26(17,18)19/h3-4,6H,2,5H2,1H3,(H,15,16)(H,20,21)(H2,10,11,12)(H2,17,18,19)/t6-/m1/s1 |
| InChIKey | IACQCQDWSIQSRP-ZCFIWIBFSA-N |
| SMILES | CC(CN1C=NC2=C1N=CN=C2N)OCP(=O)(O)OP(=O)(O)OP(=O)(O)O |
