For research use only. Not for therapeutic Use.
Tenofovir Disoproxil Aspartate(CAT: I009760) is a prodrug of tenofovir, an acyclic nucleotide reverse transcriptase inhibitor (NRTI) that effectively targets viral replication. By inhibiting the reverse transcriptase enzyme, it disrupts the synthesis of viral DNA, making it a cornerstone in the treatment and study of viral infections, particularly HIV and hepatitis B. The aspartate modification enhances its bioavailability and stability, making it a valuable tool for research into antiviral therapies. Tenofovir Disoproxil Aspartate is essential for exploring novel drug formulations and understanding resistance mechanisms, contributing significantly to advancements in virology and therapeutic development.
CAS Number | 1571075-19-8 (aspartate) |
Synonyms | Tenofovir disoproxil aspartate; CKD-390; CKD 390; CKD390.;(R)-(((((1-(6-amino-9H-purin-9-yl)propan-2-yl)oxy)methyl)phosphoryl)bis(oxy))bis(methylene) diisopropyl bis(carbonate) L-asparaginate |
Molecular Formula | C23H38N7O13P |
Purity | ≥95% |
Solubility | Soluble in DMSO |
Storage | 0 - 4 °C for short term, or -20 °C for long term |
IUPAC Name | (2S)-2-aminobutanedioic acid;[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate |
InChI | InChI=1S/C19H30N5O10P.C4H8N2O3/c1-12(2)33-18(25)28-9-31-35(27,32-10-29-19(26)34-13(3)4)11-30-14(5)6-24-8-23-15-16(20)21-7-22-17(15)24;5-2(4(8)9)1-3(6)7/h7-8,12-14H,6,9-11H2,1-5H3,(H2,20,21,22);2H,1,5H2,(H2,6,7)(H,8,9)/t14-;2-/m10/s1 |
InChIKey | WHQLGZSDBQPTHD-KJTVYDLOSA-N |
SMILES | NC1=C2C(N(C[C@H](OCP(OCOC(OC(C)C)=O)(OCOC(OC(C)C)=O)=O)C)C=N2)=NC=N1.N[C@@H](CC(N)=O)C(O)=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |