For research use only. Not for therapeutic Use.
Tenofovir disoproxil fumarate(Cat No.:A000664)is an antiretroviral medication used primarily for the treatment of HIV and chronic hepatitis B infections. As a prodrug, it is metabolized into the active compound tenofovir, which inhibits the reverse transcriptase enzyme, preventing viral replication. This compound is typically administered in combination with other antiretrovirals to enhance therapeutic efficacy and reduce resistance development. Tenofovir disoproxil fumarate is known for its high bioavailability and effectiveness in managing HIV viral load. It is also being studied for its potential use in pre-exposure prophylaxis (PrEP) for HIV prevention.
CAS Number | 202138-50-9 |
Synonyms | GS-1278 Disoproxil Fumarate |
Molecular Formula | C₁₉H₃₀N₅O₁₀P. C₄H₄O₄ |
Purity | ≥95% |
Target | HIV |
Solubility | >31.8mg/mL in DMSO |
Storage | 3 years -20C powder |
IUPAC Name | [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate;(E)-but-2-enedioic acid |
InChI | InChI=1S/C19H30N5O10P.C4H4O4/c1-12(2)33-18(25)28-9-31-35(27,32-10-29-19(26)34-13(3)4)11-30-14(5)6-24-8-23-15-16(20)21-7-22-17(15)24;5-3(6)1-2-4(7)8/h7-8,12-14H,6,9-11H2,1-5H3,(H2,20,21,22);1-2H,(H,5,6)(H,7,8)/b;2-1+/t14-;/m1./s1 |
InChIKey | VCMJCVGFSROFHV-WZGZYPNHSA-N |
SMILES | C[C@H](CN1C=NC2=C(N=CN=C21)N)OCP(=O)(OCOC(=O)OC(C)C)OCOC(=O)OC(C)C.C(=C/C(=O)O)\C(=O)O |