For research use only. Not for therapeutic Use.
Tenovin-3n(Cat.No:I000115) is a small molecule compound known for its role as a sirtuin inhibitor. It targets the sirtuin enzymes, affecting various cellular processes like DNA repair and cell cycle regulation. Tenovin-3 has shown potential in preclinical studies as a candidate for cancer therapy due to its ability to induce apoptosis in cancer cells.
| Catalog Number | I000115 |
| CAS Number | 1011301-27-1 |
| Synonyms | Tenovin 3 |
| Molecular Formula | C18H21N3OS |
| Purity | ≥95% |
| Target | MDM-2/p53 |
| Solubility | DMSO: ＞ 31 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | N-[(4-aminophenyl)carbamothioyl]-4-tert-butylbenzamide |
| InChI | InChI=1S/C18H21N3OS/c1-18(2,3)13-6-4-12(5-7-13)16(22)21-17(23)20-15-10-8-14(19)9-11-15/h4-11H,19H2,1-3H3,(H2,20,21,22,23) |
| InChIKey | NLAXTZPUTNGRDU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C(NC(NC2=CC=C(N)C=C2)=S)=O)C=C1 |
| Reference | [1]. Lain S, et al. Discovery, in vivo activity, and mechanism of action of a small-molecule p53 activator. Cancer Cell. 2008 May;13(5):454-63. |
