For research use only. Not for therapeutic Use.
Tenovin-6 HCl(Cat No.:I009763)is a small molecule inhibitor primarily studied for its potential to modulate the activity of sirtuins, a family of proteins involved in regulating cellular processes like aging, DNA repair, and metabolism. Tenovin-6 HCl has shown promise in preclinical research as a potential anticancer agent, as it may promote cell death in cancer cells while protecting normal cells. Additionally, it has been investigated for its neuroprotective effects and role in enhancing autophagy, which helps maintain cellular health. Despite its promising effects in laboratory studies, its clinical application is still under evaluation.
CAS Number | 1011301-29-3 (HCl) |
Synonyms | Tenovin6; Tenovin 6; Tenovin-6; Tnv-6; Tenovin-6 HCl.;4-(tert-butyl)-N-((4-(5-(dimethylamino)pentanamido)phenyl)carbamothioyl)benzamide hydrochloride |
Molecular Formula | C25H35ClN4O2S |
Purity | ≥95% |
Target | SIRT2 inhibitor |
Solubility | Soluble in DMSO, not in water |
Storage | 0 - 4 °C for short term, or -20 °C for long term |
IUPAC Name | 4-tert-butyl-N-[[4-[5-(dimethylamino)pentanoylamino]phenyl]carbamothioyl]benzamide;hydrochloride |
InChI | InChI=1S/C25H34N4O2S.ClH/c1-25(2,3)19-11-9-18(10-12-19)23(31)28-24(32)27-21-15-13-20(14-16-21)26-22(30)8-6-7-17-29(4)5;/h9-16H,6-8,17H2,1-5H3,(H,26,30)(H2,27,28,31,32);1H |
InChIKey | UBNCTIDXQDCEPI-UHFFFAOYSA-N |
SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)NC(=S)NC2=CC=C(C=C2)NC(=O)CCCCN(C)C.Cl |