For research use only. Not for therapeutic Use.
Terameprocol is a synthetic derivative of nordihydroguaiaretic acid (NDGA) with potential anticancer and antiviral properties. It inhibits the Sp1 transcription factor, disrupting cancer cell proliferation and inducing apoptosis. Used in clinical research, Terameprocol is significant for developing new therapeutic agents, offering promising strategies for treating various cancers and viral infections by targeting specific molecular pathways.
CAS Number | 5701-82-6 |
Synonyms | 1,1’-(2,3-Dimethyl-1,4-butanediyl)bis[3,4-dimethoxybenzene; 1,4-bis(3,4-Dimethoxyphenyl)-2,3-dimethylbutane; 1,4-Bis(3,4-dimethoxyphenyl)-2,3-dimethylbutane; Dimethyldihydroguaiaretic Acid?NSC 136955; Tetra-O-methyl nordihydroguaiaretic Acid; |
Molecular Formula | C22H30O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-[4-(3,4-dimethoxyphenyl)-2,3-dimethylbutyl]-1,2-dimethoxybenzene |
InChI | InChI=1S/C22H30O4/c1-15(11-17-7-9-19(23-3)21(13-17)25-5)16(2)12-18-8-10-20(24-4)22(14-18)26-6/h7-10,13-16H,11-12H2,1-6H3 |
InChIKey | ORQFDHFZSMXRLM-UHFFFAOYSA-N |
SMILES | CC(CC1=CC(=C(C=C1)OC)OC)C(C)CC2=CC(=C(C=C2)OC)OC |