For research use only. Not for therapeutic Use.
Terazosin is a potent and selective α<sub>1</sub>-adrenergic receptor (α<sub>1</sub>-AR) antagonist (K<sub>i</sub>s = 3.28, 0.68, and 1.09 for α<sub>1A</sub>-, α<sub>1B</sub>- and α<sub>1D</sub>-ARs, respectively). It is selective for α<sub>1</sub>- over α<sub>2</sub>-AR subtypes (K<sub>i</sub>s = 1,510, 7.71, and 78.2 nM for A<sub>2a</sub>-, A<sub>2b</sub>-, and A<sub>2c</sub>-ARs, respectively). Terazosin (0.1-30 mg/kg) decreases blood pressure in spontaneously hypertensive rats. It also decreases blood pressure in anesthetized dogs. Formulations containing terazosin are used to treat hypertension and benign prostatic hyperplasia.
| Catalog Number | A000034 |
| CAS Number | 63074-08-8 |
| Synonyms | Terazosin, Hytrin, Zayasel, Terazosine, Flumarc, Fosfomic, Blavin |
| Molecular Formula | C19H26ClN5O4 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Storage | -20°C |
| IUPAC Name | [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(oxolan-2-yl)methanone;hydrochloride |
| InChI | InChI=1S/C19H25N5O4.ClH/c1-26-15-10-12-13(11-16(15)27-2)21-19(22-17(12)20)24-7-5-23(6-8-24)18(25)14-4-3-9-28-14;/h10-11,14H,3-9H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | IWSWDOUXSCRCKW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC(=N2)N3CCN(CC3)C(=O)C4CCCO4)N)OC.Cl |
