For research use only. Not for therapeutic Use.
Terbutryn-d9(Cat No.:R013500) is a high-purity, deuterated herbicide essential for advanced environmental and agricultural research. This isotopically labeled version of Terbutryn features nine deuterium atoms, allowing for precise tracking in studies of pesticide metabolism and environmental fate. Its stable isotope labeling ensures accurate and reproducible results, making it ideal for use in NMR spectroscopy, mass spectrometry, and other analytical techniques. This compound is crucial for researchers focusing on herbicide residue analysis, degradation pathways, and toxicology, offering a robust and reliable solution for high-precision scientific investigations.
Catalog Number | R013500 |
CAS Number | 1246817-01-5 |
Synonyms | N2-(1,1-Dimethylethyl-d9)-N4-ethyl-6-(methylthio)-1,3,5-triazine-2,4-diamine; 2-Ethylamino-4-methylthio-6-tert-(butyl-d9)amino-1,3,5-triazine; 2-Methylthio-4-ethylamino-6-tert-(butyl-d9)amino-s-triazine; A 1866-d9; Clarosan-d9; GS 14260-d9; Igran-d9; |
Molecular Formula | C10H19N5S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-N-ethyl-2-N-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-6-methylsulfanyl-1,3,5-triazine-2,4-diamine |
InChI | InChI=1S/C10H19N5S/c1-6-11-7-12-8(15-10(2,3)4)14-9(13-7)16-5/h6H2,1-5H3,(H2,11,12,13,14,15)/i2D3,3D3,4D3 |
InChIKey | IROINLKCQGIITA-WVZRYRIDSA-N |
SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])NC1=NC(=NC(=N1)NCC)SC |