For research use only. Not for therapeutic Use.
Teriflunomide-d4 is a high-purity deuterated compound essential for advanced pharmaceutical and biochemical research. This isotopically labeled version of Teriflunomide is crucial for studies involving autoimmune disease treatments, drug metabolism, and pharmacokinetics. Featuring four deuterium atoms, it ensures precise and reliable analytical results. Its advanced formulation provides enhanced stability and consistency, making it suitable for various experimental setups. Ideal for immunology research and drug development, Teriflunomide-d4 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
Catalog Number | S001014 |
CAS Number | 1185240-22-5 |
Molecular Formula | C12H5D4F3N2O2 |
Purity | ≥95% |
IUPAC Name | (Z)-2-cyano-3-hydroxy-N-[2,3,5,6-tetradeuterio-4-(trifluoromethyl)phenyl]but-2-enamide |
InChI | InChI=1S/C12H9F3N2O2/c1-7(18)10(6-16)11(19)17-9-4-2-8(3-5-9)12(13,14)15/h2-5,18H,1H3,(H,17,19)/b10-7-/i2D,3D,4D,5D |
InChIKey | UTNUDOFZCWSZMS-KXFGXCNQSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1C(F)(F)F)[2H])[2H])NC(=O)/C(=C(/C)\O)/C#N)[2H] |