For research use only. Not for therapeutic Use.
Terpestacin（Cat No.:M097491） is a natural compound isolated from the fungus Syncephalastrum racemosum. It has garnered interest due to its unique biological activities, particularly its ability to inhibit the replication of viruses such as human cytomegalovirus (HCMV) and Sindbis virus. The mechanism of terpestacin involves the inhibition of virus-induced cell fusion and the secretion of viral particles, effectively preventing the spread of the virus within the host. Additionally, terpestacin has shown potential in reducing the secretion of virus-induced pro-inflammatory cytokines, suggesting broader therapeutic applications in managing viral infections and associated inflammatory responses.
| Catalog Number | M097491 |
| CAS Number | 146436-22-8 |
| Synonyms | terpestacin |
| Molecular Formula | C25H38O4 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | (1R,3Z,5S,8Z,12Z,15S)-5,17-dihydroxy-18-[(2S)-1-hydroxypropan-2-yl]-4,8,12,15-tetramethylbicyclo[13.3.0]octadeca-3,8,12,17-tetraen-16-one |
| InChI | InChI=1S/C25H38O4/c1-16-7-6-8-17(2)13-14-25(5)20(11-10-18(3)21(27)12-9-16)22(19(4)15-26)23(28)24(25)29/h7,10,13,19-21,26-28H,6,8-9,11-12,14-15H2,1-5H3/b16-7-,17-13-,18-10-/t19-,20-,21+,25+/m1/s1 |
| InChIKey | UTGBBPSEQPITLF-QMDQJFAJSA-N |
| SMILES | CC1=CCCC(=CCC2(C(CC=C(C(CC1)O)C)C(=C(C2=O)O)C(C)CO)C)C |
