For research use only. Not for therapeutic Use.
(tert-Butoxycarbonyl)-D-aspartic acid is an aspartic acid derivative[1].
Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1].
| Catalog Number | R061542 |
| CAS Number | 62396-48-9 |
| Synonyms | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioic acid |
| Molecular Formula | C9H15NO6 |
| Purity | ≥95% |
| InChI | InChI=1S/C9H15NO6/c1-9(2,3)16-8(15)10-5(7(13)14)4-6(11)12/h5H,4H2,1-3H3,(H,10,15)(H,11,12)(H,13,14)/t5-/m1/s1 |
| InChIKey | KAJBMCZQVSQJDE-RXMQYKEDSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)C(=O)O |
| Reference | [1]. Luckose F, et al. Effects of amino acid derivatives on physical, mental, and physiological activities. Crit Rev Food Sci Nutr. 2015;55(13):1793-1144. |
