For research use only. Not for therapeutic Use.
(tert-Butoxycarbonyl)glycylglycylglycine (Cat No.:I043240) is a tripeptide derivative where the amino group of the first glycine residue is protected by a tert-butoxycarbonyl (Boc) group. This protection allows for controlled peptide synthesis by preventing unwanted reactions during the assembly of larger peptides. Boc-Gly-Gly-Gly serves as a useful intermediate in peptide synthesis, enabling the selective formation of complex peptides or bioactive molecules. It is commonly used in biochemical research, particularly in the development of therapeutic peptides, enzyme inhibition studies, and other applications requiring the controlled synthesis of amino acid sequences.
| CAS Number | 28320-73-2 |
| Synonyms | 2-[[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetyl]amino]acetic acid |
| Molecular Formula | C11H19N3O6 |
| Purity | ≥95% |
| IUPAC Name | 2-[[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetyl]amino]acetic acid |
| InChI | InChI=1S/C11H19N3O6/c1-11(2,3)20-10(19)14-5-8(16)12-4-7(15)13-6-9(17)18/h4-6H2,1-3H3,(H,12,16)(H,13,15)(H,14,19)(H,17,18) |
| InChIKey | GHONIQQBOSTHSL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCC(=O)NCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
