tert-Butyl β-carboline-3-carboxylate is a synthetic derivative of β-carboline, a class of compounds known for their presence in various medicinal plants and their broad pharmacological activities. This particular derivative, modified with a tert-butyl group, is used in chemical research to explore the neuropharmacological properties of β-carbolines, such as their potential anti-depressant and anti-anxiety effects. Its structure makes it a valuable tool in the synthesis and study of new therapeutic agents targeting neurological disorders.
Catalog Number | R058685 |
CAS Number | 93835-05-3 |
Synonyms | 9H-Pyrido[3,4-b]indole-3-carboxylic Acid 1,1-Dimethylethyl Ester; β-CCT; |
Molecular Formula | C16H16N2O2 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | tert-butyl 9H-pyrido[3,4-b]indole-3-carboxylate |
InChI | InChI=1S/C16H16N2O2/c1-16(2,3)20-15(19)13-8-11-10-6-4-5-7-12(10)18-14(11)9-17-13/h4-9,18H,1-3H3 |
InChIKey | FVFFDKKTXYVCCW-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)C1=NC=C2C(=C1)C3=CC=CC=C3N2 |