For research use only. Not for therapeutic Use.
tert-Butyl (1-(3-(hydroxymethyl)phenyl)ethyl)carbamate (Cat.No:L003964) is a notable chemical compound with applications in pharmaceutical research. Its distinctive structure, combining a tert-butyl carbamate and a hydroxymethylphenyl moiety, imparts unique reactivity. This compound serves as a crucial intermediate in the synthesis of specialized molecules with potential pharmaceutical activity.
CAS Number | 1056675-39-8 |
Molecular Formula | C14H21NO3 |
Purity | ≥95% |
IUPAC Name | tert-butyl N-[1-[3-(hydroxymethyl)phenyl]ethyl]carbamate |
InChI | InChI=1S/C14H21NO3/c1-10(15-13(17)18-14(2,3)4)12-7-5-6-11(8-12)9-16/h5-8,10,16H,9H2,1-4H3,(H,15,17) |
InChIKey | GOQJIYZNPOOWBR-UHFFFAOYSA-N |
SMILES | CC(C1=CC=CC(=C1)CO)NC(=O)OC(C)(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |