For research use only. Not for therapeutic Use.
Tert-butyl (1-(6-chloropyridin-3-yl)cyclobutyl)carbamate (Cat.No:L003814) is a pivotal compound in pharmaceutical research. Its unique structure, featuring a cyclobutyl carbamate and a chloropyridine group, imparts distinct reactivity. This compound serves as a valuable scaffold in the synthesis of specialized molecules with potential pharmacological applications. Its versatile nature makes it a crucial building block in the quest for innovative drug candidates, underscoring its significance in contemporary medicinal chemistry.
Catalog Number | L003814 |
CAS Number | 1887059-70-2 |
Molecular Formula | C14H19ClN2O2 |
Purity | ≥95% |
IUPAC Name | tert-butyl N-[1-(6-chloropyridin-3-yl)cyclobutyl]carbamate |
InChI | InChI=1S/C14H19ClN2O2/c1-13(2,3)19-12(18)17-14(7-4-8-14)10-5-6-11(15)16-9-10/h5-6,9H,4,7-8H2,1-3H3,(H,17,18) |
InChIKey | HBMCLYVUBJJSHQ-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)NC1(CCC1)C2=CN=C(C=C2)Cl |