Home
>
Chemical Reagents>Heterocyclic Building Blocks> tert-butyl 2-methyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine-1-carboxylate
For research use only. Not for therapeutic Use.
Tert-butyl 2-methyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine-1-carboxylate(Cat No.:L007259), is a chemical compound widely used in pharmaceutical research and drug development. This compound contains a tetrahydrobenzodiazepine core and a tert-butyl ester group, making it a valuable intermediate in the synthesis of biologically active compounds. Researchers utilize it to create diverse molecular structures for studying various biological activities. The presence of the benzodiazepine scaffold renders it significant in medicinal chemistry, particularly in the design and synthesis of potential therapeutic agents. Its applications contribute to the advancement of drug discovery processes and the development of novel medications.
CAS Number | 1354954-18-9 |
Molecular Formula | C15H22N2O2 |
Purity | ≥95% |
IUPAC Name | tert-butyl 4-methyl-1,2,3,4-tetrahydro-1,5-benzodiazepine-5-carboxylate |
InChI | InChI=1S/C15H22N2O2/c1-11-9-10-16-12-7-5-6-8-13(12)17(11)14(18)19-15(2,3)4/h5-8,11,16H,9-10H2,1-4H3 |
InChIKey | FDXRUMKTDGIDPZ-UHFFFAOYSA-N |
SMILES | CC1CCNC2=CC=CC=C2N1C(=O)OC(C)(C)C |