For research use only. Not for therapeutic Use.
Tert-butyl 2,4-difluorobenzoate (Cat.No:L003535) is a notable chemical compound with diverse applications in organic synthesis. Its distinctive structure, featuring a tert-butyl ester group and two fluorine atoms, lends itself to various reactions. This compound serves as a valuable building block in the creation of specialized materials and pharmaceuticals.
CAS Number | 500353-15-1 |
Molecular Formula | C11H12F2O2 |
Purity | ≥95% |
IUPAC Name | tert-butyl 2,4-difluorobenzoate |
InChI | InChI=1S/C11H12F2O2/c1-11(2,3)15-10(14)8-5-4-7(12)6-9(8)13/h4-6H,1-3H3 |
InChIKey | NIADSGDBPFELPU-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)C1=C(C=C(C=C1)F)F |