Home
>
Chemical Reagents>Heterocyclic Building Blocks> Tert-butyl 3-amino-4-cyanopyrrolidine-1-carboxylate
For research use only. Not for therapeutic Use.
Tert-butyl 3-amino-4-cyanopyrrolidine-1-carboxylate(Cat No.:L007256), is a chemical compound with the molecular formula C10H17N3O2. This compound is used in organic synthesis and medicinal chemistry research. Its unique structure, featuring a pyrrolidine ring with amino, cyano, and carboxylate functional groups, makes it valuable in the creation of diverse organic molecules. Researchers employ it as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and other biologically active compounds. Its versatile reactivity allows for modifications, enabling the development of novel molecules with specific biological properties. Its application significantly contributes to advancements in drug discovery and organic chemistry research.
CAS Number | 1305712-89-3 |
Molecular Formula | C10H17N3O2 |
Purity | ≥95% |
IUPAC Name | tert-butyl 3-amino-4-cyanopyrrolidine-1-carboxylate |
InChI | InChI=1S/C10H17N3O2/c1-10(2,3)15-9(14)13-5-7(4-11)8(12)6-13/h7-8H,5-6,12H2,1-3H3 |
InChIKey | HTFUSRKVFAHZAU-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N1CC(C(C1)N)C#N |