For research use only. Not for therapeutic Use.
Tert-Butyl 3-bromo-1H-pyrrole-1-carboxylate is a versatile intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The brominated pyrrole ring allows for various functionalization reactions, making it a valuable building block in the synthesis of complex molecules. The tert-butyl ester group provides stability during reactions, which can be easily removed under mild conditions. This compound is essential in the construction of heterocyclic compounds, facilitating the creation of novel drug candidates and bioactive molecules.
CAS Number | 475561-75-2 |
Molecular Formula | C9H12BrNO2 |
Purity | ≥95% |
IUPAC Name | tert-butyl 3-bromopyrrole-1-carboxylate |
InChI | InChI=1S/C9H12BrNO2/c1-9(2,3)13-8(12)11-5-4-7(10)6-11/h4-6H,1-3H3 |
InChIKey | CUBWQHBOCOJUCM-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N1C=CC(=C1)Br |