Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> Tert-butyl 3-fluoro-4-(hydroxymethyl)piperidine-1-carboxylate
For research use only. Not for therapeutic Use.
Tert-butyl 3-fluoro-4-(hydroxymethyl)piperidine-1-carboxylate(Cat No.:L016327), is a chemical compound used in organic synthesis and pharmaceutical research. It is a piperidine derivative containing a tert-butyl group, a fluoro group, and a hydroxymethyl group attached to the piperidine ring at different positions. This compound serves as a valuable building block in the development of various organic molecules and pharmaceutical agents. Its unique structure makes it suitable for introducing specific functionalities into target molecules.
CAS Number | 1303973-77-4 |
Molecular Formula | C11H20FNO3 |
Purity | ≥95% |
IUPAC Name | tert-butyl 3-fluoro-4-(hydroxymethyl)piperidine-1-carboxylate |
InChI | InChI=1S/C11H20FNO3/c1-11(2,3)16-10(15)13-5-4-8(7-14)9(12)6-13/h8-9,14H,4-7H2,1-3H3 |
InChIKey | UIACYDBUYRFVMD-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N1CCC(C(C1)F)CO |