Home
>
Chemical Reagents>Heterocyclic Building Blocks>
>
Tert-butyl 3,3-dimethylpiperazine-1-carboxylate
Tert-butyl 3,3-dimethylpiperazine-1-carboxylate(Cat No.:L034783)is a chemical compound featuring a piperazine ring substituted with two methyl groups and an ester group derived from tert-butyl carboxylate. This structure enhances its solubility and stability, making it useful in organic synthesis, especially in pharmaceutical chemistry for modifying pharmacokinetic properties of drug molecules. The piperazine core is commonly employed in the development of compounds with central nervous system activity, providing structural basis for potential anxiolytic, antipsychotic, or antidepressant drugs. This compound serves as a versatile intermediate for creating new therapeutic agents with enhanced efficacy and reduced side effects.
Catalog Number | L034783 |
CAS Number | 259808-67-8 |
Molecular Formula | C11H22N2O2 |
Purity | ≥95% |
IUPAC Name | tert-butyl 3,3-dimethylpiperazine-1-carboxylate |
InChI | InChI=1S/C11H22N2O2/c1-10(2,3)15-9(14)13-7-6-12-11(4,5)8-13/h12H,6-8H2,1-5H3 |
InChIKey | LBAIYWWWORXVEQ-UHFFFAOYSA-N |
SMILES | CC1(CN(CCN1)C(=O)OC(C)(C)C)C |