For research use only. Not for therapeutic Use.
tert-Butyl ((3S,4S)-1-chloro-4-methyl-2-oxohexan-3-yl)carbamate (Cat.No:L003719) is a vital chemical compound in pharmaceutical research. Its chiral, chlorinated structure presents a valuable scaffold for drug development. This compound serves as a key intermediate, enabling the synthesis of complex molecules with potential therapeutic applications.
Catalog Number | L003719 |
CAS Number | 161805-78-3 |
Molecular Formula | C12H22ClNO3 |
Purity | ≥95% |
IUPAC Name | tert-butyl N-[(3S,4S)-1-chloro-4-methyl-2-oxohexan-3-yl]carbamate |
InChI | InChI=1S/C12H22ClNO3/c1-6-8(2)10(9(15)7-13)14-11(16)17-12(3,4)5/h8,10H,6-7H2,1-5H3,(H,14,16)/t8-,10-/m0/s1 |
InChIKey | SBYKMTUAOVCQGA-WPRPVWTQSA-N |
SMILES | CC[C@H](C)[C@@H](C(=O)CCl)NC(=O)OC(C)(C)C |