Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> tert-butyl (3S,4S)-3-amino-4-fluoropiperidine-1-carboxylate
For research use only. Not for therapeutic Use.
Tert-butyl (3S,4S)-3-amino-4-fluoropiperidine-1-carboxylate(Cat No.:L016087), is a chemical compound used in organic synthesis and pharmaceutical research. It is a piperidine derivative with a tert-butyl group, an amino group, and a fluorine atom attached to different positions of the piperidine ring. This compound serves as a valuable intermediate in the synthesis of various organic molecules and pharmaceutical compounds. Its unique structure makes it suitable for introducing specific functional groups into target molecules.
CAS Number | 1290191-71-7 |
Molecular Formula | C10H19FN2O2 |
Purity | ≥95% |
Storage | 2–8 °C |
IUPAC Name | tert-butyl (3S,4S)-3-amino-4-fluoropiperidine-1-carboxylate |
InChI | InChI=1S/C10H19FN2O2/c1-10(2,3)15-9(14)13-5-4-7(11)8(12)6-13/h7-8H,4-6,12H2,1-3H3/t7-,8-/m0/s1 |
InChIKey | CVHJEFDRBTZVEL-YUMQZZPRSA-N |
SMILES | CC(C)(C)OC(=O)N1CCC(C(C1)N)F |