Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> tert-butyl (3S,5S)-3-amino-5-fluoropiperidine-1-carboxylate
For research use only. Not for therapeutic Use.
Tert-butyl (3S,5S)-3-amino-5-fluoropiperidine-1-carboxylate (Cat No.:L005472) is an organic compound featuring a tert-butyl group linked to a piperidine ring with an amino group at the 3rd position and a fluorine atom at the 5th position. This unique structure indicates potential applications in pharmaceutical research, where piperidine-based compounds often display bioactive properties. The tert-butyl group enhances stability, and the fluorine atom introduces specific chemical reactivity. This compound may serve as a valuable building block or lead compound in the development of new drugs or biologically active molecules.
CAS Number | 1932056-72-8 |
Molecular Formula | C10H19FN2O2 |
Purity | ≥95% |
IUPAC Name | tert-butyl (3S,5S)-3-amino-5-fluoropiperidine-1-carboxylate |
InChI | InChI=1S/C10H19FN2O2/c1-10(2,3)15-9(14)13-5-7(11)4-8(12)6-13/h7-8H,4-6,12H2,1-3H3/t7-,8-/m0/s1 |
InChIKey | QHVIBSNJHHGNCZ-YUMQZZPRSA-N |
SMILES | CC(C)(C)OC(=O)N1CC(CC(C1)F)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |