Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> tert-Butyl 4-(1-amino-2-hydroxyethyl)piperidine-1-carboxylate hydrochloride
For research use only. Not for therapeutic Use.
tert-Butyl 4-(1-amino-2-hydroxyethyl)piperidine-1-carboxylate hydrochloride(Cat No.:L018347), is a chemical compound used in organic synthesis and pharmaceutical research. It is a piperidine derivative containing a tert-butyl group, an amino group, and a carboxylate group attached to the piperidine ring at different positions. The hydrochloride form is a common salt used for stability and handling purposes. This compound serves as a valuable intermediate in the synthesis of various organic molecules and pharmaceutical compounds. Its unique structure makes it suitable for introducing specific functional groups into target molecules.
Catalog Number | L018347 |
CAS Number | 2044704-67-6 |
Molecular Formula | C12H25ClN2O3 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | tert-butyl 4-(1-amino-2-hydroxyethyl)piperidine-1-carboxylate;hydrochloride |
InChI | InChI=1S/C12H24N2O3.ClH/c1-12(2,3)17-11(16)14-6-4-9(5-7-14)10(13)8-15;/h9-10,15H,4-8,13H2,1-3H3;1H |
InChIKey | PGGIIYFWQLVTPJ-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C(CO)N.Cl |