Home
>
Chemical Reagents>Heterocyclic Building Blocks> Tert-butyl 4-(4-(aminomethyl)benzyl)piperazine-1-carboxylate
For research use only. Not for therapeutic Use.
Tert-butyl 4-(4-(aminomethyl)benzyl)piperazine-1-carboxylate(Cat No.:L007546), is a chemical compound featuring a piperazine ring substituted with a tert-butyl ester group at the 1st position and a 4-(aminomethyl)benzyl group at the 4th position. This compound is significant in medicinal chemistry and drug discovery. Its unique structure suggests potential pharmacological activities, making it valuable for further exploration in the development of pharmaceutical agents. Researchers study its reactivity and interactions with biological targets, aiming to design novel drugs. Investigations involving this compound contribute to advancements in medicinal chemistry, fostering the development of innovative therapies for various medical applications, including neuroscience and oncology.
CAS Number | 1415109-59-9 |
Molecular Formula | C17H27N3O2 |
Purity | ≥95% |
IUPAC Name | tert-butyl 4-[[4-(aminomethyl)phenyl]methyl]piperazine-1-carboxylate |
InChI | InChI=1S/C17H27N3O2/c1-17(2,3)22-16(21)20-10-8-19(9-11-20)13-15-6-4-14(12-18)5-7-15/h4-7H,8-13,18H2,1-3H3 |
InChIKey | FOMCSHUOASRGHK-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N1CCN(CC1)CC2=CC=C(C=C2)CN |