For research use only. Not for therapeutic Use.
Tert-butyl 4-(6-aminopyridin-3-yl)piperidine-1-carboxylate (Cat.No:M143521) is a chemical compound with potential applications in medicinal chemistry and drug development. It contains a piperidine ring functionalized with an aminopyridinyl group. This compound may serve as a valuable building block in the synthesis of pharmaceutical agents and bioactive molecules for various research purposes.
Catalog Number | M143521 |
CAS Number | 1198408-35-3 |
Synonyms | tert-butyl 4-(6-aMinopyridin-3-yl)piperidine-1-carboxylate |
Molecular Formula | C15H23N3O2 |
Purity | ≥95% |
Storage | Store at -20℃ |
IUPAC Name | tert-butyl 4-(6-aminopyridin-3-yl)piperidine-1-carboxylate |
InChI | InChI=1S/C15H23N3O2/c1-15(2,3)20-14(19)18-8-6-11(7-9-18)12-4-5-13(16)17-10-12/h4-5,10-11H,6-9H2,1-3H3,(H2,16,17) |
InChIKey | UGJYTOMOCDGLRS-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C2=CN=C(C=C2)N |